|
| 2,4,5-Trifluorobenzoyl chloride Basic information |
Product Name: | 2,4,5-Trifluorobenzoyl chloride | Synonyms: | AKOS 91963;2,4,5-TRIFLUOROBENZOYL CHLORIDE;TIMTEC-BB SBB006657;2,4,5-Trifluorobenzoyl;2,4,5-Trifluorobenzoyl chloride 99%;2,4,5-Trifluorobenzoylchloride99%;Benzoyl chloride, 2,4,5-trifluoro- (9CI);2,4,5-Trifluorobenzoic acid chloride | CAS: | 88419-56-1 | MF: | C7H2ClF3O | MW: | 194.54 | EINECS: | | Product Categories: | Organic Building Blocks;Carbonyl Chlorides;Phenyls & Phenyl-Het;Miscellaneous;Carbonyl Chlorides;Phenyls & Phenyl-Het;Acid Halides;Carbonyl Compounds;ACIDHALIDE | Mol File: | 88419-56-1.mol | |
| 2,4,5-Trifluorobenzoyl chloride Chemical Properties |
Boiling point | 85°C 17mm | density | 1.52 g/mL at 25 °C(lit.) | refractive index | n20/D 1.498(lit.) | Fp | 188 °F | form | Liquid | Specific Gravity | 1.520 | color | Clear colorless | Sensitive | Lachrymatory | BRN | 3606259 | InChI | InChI=1S/C7H2ClF3O/c8-7(12)3-1-5(10)6(11)2-4(3)9/h1-2H | InChIKey | STBGCAUUOPNJBH-UHFFFAOYSA-N | SMILES | C(Cl)(=O)C1=CC(F)=C(F)C=C1F | CAS DataBase Reference | 88419-56-1(CAS DataBase Reference) |
Hazard Codes | C | Risk Statements | 34 | Safety Statements | 26-36/37/39-45-25 | RIDADR | UN 3265 8/PG 2 | WGK Germany | 3 | F | 19-21 | Hazard Note | Corrosive/Lachrymatory | HazardClass | 8 | PackingGroup | II | HS Code | 29163990 |
| 2,4,5-Trifluorobenzoyl chloride Usage And Synthesis |
Chemical Properties | clear colorless liquid |
| 2,4,5-Trifluorobenzoyl chloride Preparation Products And Raw materials |
|