|
|
| | 2-Fluoro-6-methoxyphenylboronic acid Basic information |
| | 2-Fluoro-6-methoxyphenylboronic acid Chemical Properties |
| Melting point | 120-125 °C (lit.) | | Boiling point | 303.1±52.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 8.35±0.58(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C7H8BFO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,10-11H,1H3 | | InChIKey | XOVMDVZAWWQSDC-UHFFFAOYSA-N | | SMILES | B(C1=C(OC)C=CC=C1F)(O)O | | CAS DataBase Reference | 78495-63-3(CAS DataBase Reference) |
| | 2-Fluoro-6-methoxyphenylboronic acid Usage And Synthesis |
| Uses | suzuki reaction | | Uses | Reactant for:• ;Preparation of functionally selective allosteric modulators of GABAA receptors1• ;Suzuki cross-coupling reaction2,3• ;Preparation of inhibitors of the checkpoint kinase Wee14 | | Uses | 2-Fluoro-6-methoxyphenylboronic Acid is a boronic acid derivative known for its pharmacological activity and utility as intermediates in the synthesis of novel non-boron containing compounds, and potential bacterial mutagens. |
| | 2-Fluoro-6-methoxyphenylboronic acid Preparation Products And Raw materials |
|