|
|
| | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides Basic information |
| Product Name: | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides | | Synonyms: | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides;PYRIDINE-BENZYL QUATERNARY AMMONIUM COMPOUND;Pyridinium, 1-(phenylmethyl)-, Et Me derivs., chlorides;Alkyl pyridine, benzylchloride quaternized;Alkyl pyridine,benzylchloride quaternized;1-(Phenylmethyl)pyridinium Et Me derivs. Chlorides;Composite pyridine quaternary ammonium salt;1-(Phenylmethyl)pyridinium, ethyl methyl derivs., chlorides | | CAS: | 68909-18-2 | | MF: | C13H16ClN | | MW: | 221.72584 | | EINECS: | 272-695-0 | | Product Categories: | Intermediate | | Mol File: | 68909-18-2.mol |  |
| | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides Chemical Properties |
| Boiling point | 116.34℃[at 101 325 Pa] | | density | 1.104[at 20℃] | | vapor pressure | 2hPa at 20℃ | | Water Solubility | 100g/L at 30℃ | | InChI | InChI=1S/C13H16N.ClH/c1-14(10-6-3-7-11-14)12-13-8-4-2-5-9-13;/h2-10H,11-12H2,1H3;1H/q+1;/p-1 | | InChIKey | NBNVYJFZJWMHPR-UHFFFAOYSA-M | | SMILES | C1[N+](CC2=CC=CC=C2)(C)C=CC=C1.[Cl-] | | LogP | 3 at 25℃ | | EPA Substance Registry System | 1-(Phenylmethyl)pyridinium Et Me derivs., chlorides (68909-18-2) |
| | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides Usage And Synthesis |
| Chemical Properties | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides is dark brown liquid | | Uses | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides is used as a water soluble and/or oil dispersable corrosion inhibitor. | | Uses | Uniquat(R) PB-801 is used as a water soluble and/or oil dispersable corrosion inhibitor. |
| | Pyridinium, 1-(phenylmethyl)-, ethyl methyl derivs., chlorides Preparation Products And Raw materials |
|