| Company Name: |
Shanghai TenSus Biotechnology Co., Ltd.
|
| Tel: |
021-50895067 18616507272 |
| Email: |
tensus@163.com |
| Products Intro: |
Product Name:5,12-dihydroquinoxalino[2,3-b]quinoxaline
CAS:531-46-4
Purity:＞97% Package:500mg；1g；5g；10g
|
|
| | 5,12-dihydroquinoxalino[2,3-b]quinoxaline Basic information |
| Product Name: | 5,12-dihydroquinoxalino[2,3-b]quinoxaline | | Synonyms: | 5,12-dihydroquinoxalino[2,3-b]quinoxaline;Fluoflavine;ML-090;Quinoxalino[2,3-b]quinoxaline, 5,11-dihydro-;5,12-Dihydroquinoxalino[2,3-b]quinoxaline (~90%);6,11-dihydroquinoxalino[2,3-b]quinoxaline;NOX4,ML090,NADPH Oxidase,Inhibitor,NOX,HEK293 cell,NOX3,ML 090,NOX2,inhibit,ML-090,NOX1 | | CAS: | 531-46-4 | | MF: | C14H10N4 | | MW: | 234.26 | | EINECS: | | | Product Categories: | | | Mol File: | 531-46-4.mol | ![5,12-dihydroquinoxalino[2,3-b]quinoxaline Structure](CAS/GIF/531-46-4.gif) |
| | 5,12-dihydroquinoxalino[2,3-b]quinoxaline Chemical Properties |
| Melting point | >262°C (dec.) | | Boiling point | 450.2±28.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly, Heated, Sonicated) | | form | Solid | | pka | 3.94±0.20(Predicted) | | color | Off-White to Dark Yellow | | InChI | InChI=1S/C14H10N4/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13/h1-8H,(H,15,17)(H,16,18) | | InChIKey | WGKYYZDYHYOKQV-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)N=C2NC3=C(N=C12)C=CC=C3 |
| | 5,12-dihydroquinoxalino[2,3-b]quinoxaline Usage And Synthesis |
| Description | NADPH oxidase 1 (NOX1) generates reactive oxygen species (ROS) in colon epithelial cells that interacts with both pathogenic and normal bacteria. Excess ROS production, however, is associated with damage to the intestinal mucosa, inflammatory bowel disease, and prostate cancer. ML-090 is the first identified NOX1-specific inhibitor (IC50 = 360 nM in HEK293 cells) based on a quinoxaline scaffold that demonstrates potent selectivity over NOX2, NOX3, and NOX4 (IC50s ≥ 10 μM) and xanthine oxidase (IC50 = 3.5 μM). | | Uses | 5,12-Dihydroquinoxalino[2,3-b]quinoxaline is an inhibitor of?NADPH oxidase 1 (NOX1). | | Definition | ChEBI: 6,11-dihydroquinoxalino[2,3-b]quinoxaline is a quinoxaline derivative. |
| | 5,12-dihydroquinoxalino[2,3-b]quinoxaline Preparation Products And Raw materials |
|