| Company Name: |
Suzhou origin Specialty Chemicals Co., Ltd
|
| Tel: |
17701559125 |
| Email: |
jiaoshangjun@origsc.com |
| Products Intro: |
Product Name:1,3-Dimethyl-2-thiobarbituricacid
CAS:3158-63-2
Purity:98% Package:100g;1kg;5kg
|
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Email: |
sales@carbosynth.com |
| Products Intro: |
Product Name:1,3-Dimethyl-2-thiobarbituricacid
CAS:3158-63-2
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
+1 (201) 478-8534 |
| Email: |
info@Alfa-Chemistry.com |
| Products Intro: |
|
|
| | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione Basic information |
| Product Name: | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione | | Synonyms: | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione;1,3-Dimethyl-2-thiobarbituric acid;N,N'-Dimethyl-2-thiobarbituric acid;4,6(1H,5H)-Pyrimidinedione, dihydro-1,3-dimethyl-2-thioxo-;Roxatidine Impurity 2-d10 (Roxatidine Acetate HCl-d10) | | CAS: | 3158-63-2 | | MF: | C6H8N2O2S | | MW: | 172.2 | | EINECS: | | | Product Categories: | | | Mol File: | 3158-63-2.mol |  |
| | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione Chemical Properties |
| Melting point | 183℃ | | Boiling point | 238℃ | | density | 1.40 | | Fp | 98℃ | | pka | 4.69±0.20(Predicted) | | InChI | InChI=1S/C6H8N2O2S/c1-7-4(9)3-5(10)8(2)6(7)11/h3H2,1-2H3 | | InChIKey | NWWZLDXOHWTTKD-UHFFFAOYSA-N | | SMILES | C1(=S)N(C)C(=O)CC(=O)N1C |
| | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione Usage And Synthesis |
| | Dihydro-1,3-dimethyl-2-thioxo-4,6(1H,5H)-pyrimidinedione Preparation Products And Raw materials |
|