|
| 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane Basic information |
Product Name: | 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane | Synonyms: | 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane;Tetramethyl diphenyl dihydrogen trisiloxane;1,1,5,5-Tetramethyl-3,3-diphenylpentanetrisiloxane;Bis(dimethylsiloxy)diphenylsilane;1,3,3,5-Tetramethyl-1,5-diphenyltrisiloxane;3,3-DIPHENYLTETRAMETHYLTRISILOXANE;Ph2Si[OSiMe2H]2;Trisiloxane, 1,1,5,5-tetramethyl-3,3-diphenyl- | CAS: | 17875-55-7 | MF: | C16H24O2Si3 | MW: | 332.62 | EINECS: | 2418284 | Product Categories: | 17875-55-7 | Mol File: | 17875-55-7.mol | |
| 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane Chemical Properties |
Boiling point | 292℃ | density | 0.9936 | refractive index | 1.5330 | Fp | 130℃ | form | clear liquid | color | Colorless to Almost colorless | Specific Gravity | 0.9936 | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | InChI | InChI=1S/C16H24O2Si3/c1-19(2)17-21(18-20(3)4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,19-20H,1-4H3 | InChIKey | SBURHUAIGVFSSI-UHFFFAOYSA-N | SMILES | [SiH](C)(C)O[Si](C1=CC=CC=C1)(C1=CC=CC=C1)O[SiH](C)C | EPA Substance Registry System | Trisiloxane, 1,1,5,5-tetramethyl-3,3-diphenyl- (17875-55-7) |
| 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane Usage And Synthesis |
| 1,1,5,5-tetramethyl-3,3-diphenyltrisiloxane Preparation Products And Raw materials |
|