| Company Name: |
Hubei Xinkang Pharmaceutical Chemical Co., Ltd
|
| Tel: |
027-027-59308705 18871579363 |
| Email: |
1248680011@qq.com |
| Products Intro: |
Product Name:Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether
CAS:69029-39-6
Purity:99% HPLC Package:25KG;200KG;5KG;1KG;1T
|
| Company Name: |
Hubei Shishun Biotechnology Co. Ltd
|
| Tel: |
027-59223025 15107168801 |
| Email: |
1718480011@qq.com |
| Products Intro: |
Product Name:Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether
CAS:69029-39-6
Purity:99% HPLC Package:25KG;200KG;5KG;1KG;1T
|
|
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Basic information |
| Product Name: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether | | Synonyms: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether;Oxirane, methyl oxirane, bis(1-methylpropyl)phenyl polymer;di(sec-butyl)phenol ethoxylated, propoxylated;Alkylphenol alkoxylate;Ethoxylated propoxylated di-sec-butylphenol;Oxirane polymer with methyloxirane mono[bis(1-methylpropyl)phenyl] ether;PG 26-2;PG 26-3 | | CAS: | 69029-39-6 | | MF: | C14H22O.(C3H6O)n.(C2H4O)x | | MW: | 0 | | EINECS: | | | Product Categories: | Polymers | | Mol File: | Mol File | ![Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Structure]() |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Chemical Properties |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Usage And Synthesis |
| | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether Preparation Products And Raw materials |
|