|
|
| | 3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Basic information |
| Product Name: | 3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID | | Synonyms: | InChI=1/C5H6N2O2/c1-3-2-4(5(8)9)7-6-3/h2H,1H3,(H,6,7)(H,8,9;Pyrazole-3-carboxylic acid, 5-methyl-;Pyrazole-5-carboxylic acid, 3-methyl-;3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID;3-methyl-1H-pyrazole-5-carboxylic acid(SALTDATA: FREE);3-Methyl-5-pyrazolecarboxylic acid;1H-Pyrazole-3-carboxylic acid, 5-Methyl-;5(or 3)-Methyl-pyrazole-3(or 5)-carboxylic Acid | | CAS: | 696-22-0 | | MF: | C5H6N2O2 | | MW: | 126.11 | | EINECS: | | | Product Categories: | | | Mol File: | 696-22-0.mol |  |
| | 3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Chemical Properties |
| Melting point | 236-240℃ | | storage temp. | 2-8°C |
| | 3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Usage And Synthesis |
| Definition | ChEBI: 5-methyl-pyrazole-3-carboxylic acid is a memebr of the class of pyrazoles that is 1H-pyrazole with methyl and carboxylic acid group substituents at positions 5 and 3 respectively. It has a role as a metabolite. It is a member of pyrazoles and a monocarboxylic acid. It derives from a hydride of a 1H-pyrazole. |
| | 3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID Preparation Products And Raw materials |
|