|
|
| | 1-BENZYL-3-PHENYL-2-THIOUREA Basic information |
| Product Name: | 1-BENZYL-3-PHENYL-2-THIOUREA | | Synonyms: | 1-Benzyl-3-phenylthiourea;N-Benzyl-N'-phenylthiourea;N-Phenyl-N'-benzylthiourea;Thiourea, N-phenyl-N'-(phenylmethyl)-;1-Phenyl-3-benzylthiourea;1-BENZYL-3-PHENYL-2-THIOUREA;(E)-N-benzyl-N-phenylcarbamimidothioic acid | | CAS: | 726-25-0 | | MF: | C14H14N2S | | MW: | 242.34 | | EINECS: | | | Product Categories: | | | Mol File: | 726-25-0.mol |  |
| | 1-BENZYL-3-PHENYL-2-THIOUREA Chemical Properties |
| Melting point | 156-158°C | | Boiling point | 377.7±35.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 12.68±0.70(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C14H14N2S/c17-14(16-13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,15,16,17) | | InChIKey | NXCBDDGSOXJEFZ-UHFFFAOYSA-N | | SMILES | N(C1=CC=CC=C1)C(NCC1=CC=CC=C1)=S | | CAS DataBase Reference | 726-25-0(CAS DataBase Reference) |
| RIDADR | UN 2811 6.1/PG III | | HS Code | 2930.90.2900 | | HazardClass | IRRITANT | | PackingGroup | III |
| | 1-BENZYL-3-PHENYL-2-THIOUREA Usage And Synthesis |
| | 1-BENZYL-3-PHENYL-2-THIOUREA Preparation Products And Raw materials |
|