| Company Name: |
Jinan ponder chemical co. LTD
|
| Tel: |
0531-0000 |
| Email: |
thinklifescience@163.com |
| Products Intro: |
Product Name:608515-73-7
CAS:608515-73-7
Purity:99% HPLC Package:1KG;500G;100G;50G;1G
|
| Company Name: |
Beijing Stronger Science Co., Ltd.
|
| Tel: |
0531-88924771 15614660963 |
| Email: |
elsa.hang@strongerscience.com |
| Products Intro: |
CAS:608515-73-7
Purity:0.95 Package:1g
|
|
| | 5-Isoquinolinamine,7-fluoro-(9CI) Basic information |
| | 5-Isoquinolinamine,7-fluoro-(9CI) Chemical Properties |
| Boiling point | 342.2±27.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | pka | 5.12±0.16(Predicted) | | InChI | InChI=1S/C9H7FN2/c10-7-3-6-5-12-2-1-8(6)9(11)4-7/h1-5H,11H2 | | InChIKey | AOKZHETVRHUGOY-UHFFFAOYSA-N | | SMILES | C1C2=C(C(N)=CC(F)=C2)C=CN=1 |
| | 5-Isoquinolinamine,7-fluoro-(9CI) Usage And Synthesis |
| Reactions | 5-Isoquinolinamine,7-fluoro-(9CI), also known as 7-fluoroisoquinolin-5 -amine, could synthesize 4-fluoro-N-(7- fluoroisoquinolin-5-yl)-7-methyl-lH-indole-2-carboxamide with 4-fluoro-7-methyl-lH-indole-2-carboxamide.
 |
| | 5-Isoquinolinamine,7-fluoro-(9CI) Preparation Products And Raw materials |
|