Sulfo-SANPAH manufacturers
|
| | Sulfo-SANPAH Basic information |
| Product Name: | Sulfo-SANPAH | | Synonyms: | 6-[(4-Azido-2-nitrophenyl)amino]hexanoic acid 2,5-dioxo-3-sulfo-1-pyrrolidinyl ester;Sulfo-SANPAH Crosslinker;SULFO-SANPAH;Sulfo SANPAH Crosslinker,SulfoSANPAH Crosslinker;1-[6-(4-azido-2-nitro-anilino)hexanoyloxy]-2,5-dioxo-pyrrolidine-3-sulfonic acid | | CAS: | 102568-43-4 | | MF: | C16H18N6O9S | | MW: | 470.41 | | EINECS: | | | Product Categories: | | | Mol File: | 102568-43-4.mol |  |
| | Sulfo-SANPAH Chemical Properties |
| form | solid | | color | Bright orange-red | | InChI | InChI=1S/C16H18N6O9S/c17-20-19-10-5-6-11(12(8-10)22(26)27)18-7-3-1-2-4-15(24)31-21-14(23)9-13(16(21)25)32(28,29)30/h5-6,8,13,18H,1-4,7,9H2,(H,28,29,30) | | InChIKey | UPNUQQDXHCUWSG-UHFFFAOYSA-N | | SMILES | O(N1C(CC(S(O)(=O)=O)C1=O)=O)C(=O)CCCCCNC1C=CC(N=[N+]=[N-])=CC=1N(=O)=O |
| | Sulfo-SANPAH Usage And Synthesis |
| Description | Sulfo-SANPAH crosslinker (N-Sulfosuccinimidyl-6-[4'-azido-2'-nitrophenylamino] hexanoate) is a water-soluble, heterobifunctional protein crosslinker with a spacer arm length of 18.2 angstroms. This reagent contains an NHS ester that reacts with primary amines and a nitrophenylazide group that is photoreactive at 320-350 nm toward amino groups. Sulfo-SANPAH commonly enhances Western blot experiments; likewise, Sulfo-SANPAH activated polyacrylamide (PAA) gel crosslinked to fibronectin or collagen matrix (ECM) is used in tissue culture studies.
| | Uses | Sulfo-sanpah is used as a tether between extracellular matrix protein and substrate. |
| | Sulfo-SANPAH Preparation Products And Raw materials |
|