| Company Name: |
Amadis Chemical Company Limited |
| Tel: |
571-89925085 |
| Email: |
sales@amadischem.com |
| Products Intro: |
Product Name:2-[(8R,9S,10R,13S,14S,15R,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-yl]acetic acid
CAS:678-65-9
Purity:0.97 Package:mgs,gs,kgs Remarks:A835910
|
|
|
|
|
|
| | 1,4-DIVINYLOCTAFLUOROBUTANE Basic information |
| Product Name: | 1,4-DIVINYLOCTAFLUOROBUTANE | | Synonyms: | 1,4-Divinyloctafluorobutane 97%;1,4-Divinyloctafluorobutane97%;3,3,4,4,5,5,6,6-Octafluorooctane-1,7-diene;1H,1H,2H,7H,8H,8H-Perfluoroocta-1,7-diene;1,4-DIVINYLOCTAFLUOROBUTANE;1,4-DIVINYLPERFLUOROBUTANE;DAIKIN F-9445;3,3,4,4,5,5,6,6-octafluoroocta-1,7-diene | | CAS: | 678-65-9 | | MF: | C8H6F8 | | MW: | 254.12 | | EINECS: | 211-650-1 | | Product Categories: | | | Mol File: | 678-65-9.mol |  |
| | 1,4-DIVINYLOCTAFLUOROBUTANE Chemical Properties |
| Boiling point | 123 °C | | density | 1.329 | | refractive index | 1.335 | | form | liquid | | color | clear | | Specific Gravity | 1.361 | | InChI | InChI=1S/C8H6F8/c1-3-5(9,10)7(13,14)8(15,16)6(11,12)4-2/h3-4H,1-2H2 | | InChIKey | XRSMAKAYKVRPSA-UHFFFAOYSA-N | | SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C | | CAS DataBase Reference | 678-65-9(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Divinylperfluorobutane (678-65-9) |
| | 1,4-DIVINYLOCTAFLUOROBUTANE Usage And Synthesis |
| | 1,4-DIVINYLOCTAFLUOROBUTANE Preparation Products And Raw materials |
|