(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole manufacturers
- (R)-Benzotetramisole
-
- $46.00 / 1g
-
2024-04-12
- CAS:885051-07-0
- Min. Order: 1g
- Purity: 0.98
- Supply Ability: 10kg
|
| | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Basic information |
| Product Name: | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole | | Synonyms: | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole;(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole
(+)-BTM;IMidazo[2,1-b]benzothiazole,2,3-dihydro-2-phenyl-, (2R)-;(R)-Benzotetramisole;(2R)-2-Phenyl-2,3-dihydroimidazo[2,1-b][1,3]benzothiazole98+%;(R)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole;(+)-Benzotetramisole;(+)-BTM | | CAS: | 885051-07-0 | | MF: | C15H12N2S | | MW: | 252.33 | | EINECS: | | | Product Categories: | | | Mol File: | 885051-07-0.mol | ![(2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Structure](CAS/GIF/885051-07-0.gif) |
| | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Chemical Properties |
| Melting point | 95.0-95.5℃ (ethyl ether hexane ) | | Boiling point | 428.1±48.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 7.53±0.40(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C15H12N2S/c1-2-6-11(7-3-1)12-10-17-13-8-4-5-9-14(13)18-15(17)16-12/h1-9,12H,10H2/t12-/m0/s1 | | InChIKey | YGCWPCVAVSIFLO-LBPRGKRZSA-N | | SMILES | S1C2=CC=CC=C2N2C[C@@H](C3=CC=CC=C3)N=C12 |
| | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Usage And Synthesis |
| | (2R)-2,3-Dihydro-2-phenylimidazo[2,1-b]benzothiazole Preparation Products And Raw materials |
|