|
|
| | 2-Oxo-1-benzimidazolinebutyric Acid Basic information |
| Product Name: | 2-Oxo-1-benzimidazolinebutyric Acid | | Synonyms: | 4-(2-OXO-2,3-DIHYDROBENZOIMIDAZOL-1-YL)BUTYRIC ACID;4-(2-oxo-2,3-dihydro-1H-1,3-benzimidazol-1-yl)butanoic acid;4-2-oxo-2,3-hihydro-1H-benzimidazol-1-yl)butanoic acid;2-Oxo-1-benzimidazolinebutyric Acid;2-Oxo-;Buzolic acid, >=95%;1H-BENZIMIDAZOLE-1-BUTANOIC ACID, 2,3-DIHYDRO-2-OXO;2,3-Dihydro-2-oxo-1H-benziMidazole-1-butyric acid | | CAS: | 3273-68-5 | | MF: | C11H12N2O3 | | MW: | 220.22 | | EINECS: | 690-971-2 | | Product Categories: | Aliphatics;Aromatics;Heterocycles | | Mol File: | 3273-68-5.mol |  |
| | 2-Oxo-1-benzimidazolinebutyric Acid Chemical Properties |
| Melting point | 175-176℃ | | Boiling point | 422.74℃[at 101 325 Pa] | | density | 1.316 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethyl Acetate (Very Slightly, Heated), Methanol (Slightly) | | pka | 4.75±0.10(Predicted) | | form | Solid | | color | White to Pale Brown | | InChI | InChI=1S/C11H12N2O3/c14-10(15)6-3-7-13-9-5-2-1-4-8(9)12-11(13)16/h1-2,4-5H,3,6-7H2,(H,12,16)(H,14,15) | | InChIKey | PTNUQSFEJXMNOQ-UHFFFAOYSA-N | | SMILES | C1(=O)N(CCCC(O)=O)C2=CC=CC=C2N1 | | LogP | 1.27 |
| | 2-Oxo-1-benzimidazolinebutyric Acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-Oxo-1-benzimidazolinebutyric Acid (cas# 3273-68-5) is a compound useful in organic synthesis. | | Synthesis | To a solution of the compound of Preparation 6 (152.0 g, 0.6 mol) in tetrahydrofuran (600 ml) was added concentrated hydrochloric acid (75 ml). The reaction mixture was stirred for 2 h and then poured into water (700 ml). The mixture was filtered, washing through with water (750 ml), and the solid material was dried overnight at 40°C. to give the title compound (156.0 g). 2-Oxo-1-benzimidazolinebutyric Acid, yield (156.0 g). 1H-NMR (d6-DMSO): 1.80-1.89 (2H), 2.20-2.25 (2H), 3.74-3.82 (2H), 6.96-7.01 (3H), 7.05-7.10 (1H)
 |
| | 2-Oxo-1-benzimidazolinebutyric Acid Preparation Products And Raw materials |
| Raw materials | 3-Isopropenyl-2-oxo-1-benzimidazolinebutyric Acid Ethyl Ester-->1-ISOPROPENYL-2-BENZIMIDAZOLIDINONE-->3-Isopropenyl-2-oxo-1-benzimidazolinebutyric Acid-->Methyl 4-chlorobutyrate-->Gamma Butyrolactone-->o-Phenylenediamine | | Preparation Products | 5,6-Dihydroimidazo[4,5,1-jk][1]benzazepine-2,7(1H,4H)-dione -->4,5-Dihydro-6-oxiMe-iMidazo[4,5,1-jk][1]benzazepine-2,6,7(1H)-trione |
|