|
| 2,4-Dichloro-5-trifluoromethylpyrimidine Basic information |
| 2,4-Dichloro-5-trifluoromethylpyrimidine Chemical Properties |
Boiling point | 49℃/32mm | density | 1.609 g/mL at 25 °C | refractive index | 1.4749 | Fp | 200 ºF | storage temp. | 2-8°C | solubility | Chloroform, Methanol | form | Clear Colorless to Pale Yellow Liquid | pka | -4.89±0.29(Predicted) | InChI | InChI=1S/C5HCl2F3N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H | InChIKey | VABVSVZAESMOCH-UHFFFAOYSA-N | SMILES | C1(Cl)=NC=C(C(F)(F)F)C(Cl)=N1 | CAS DataBase Reference | 3932-97-6(CAS DataBase Reference) |
Hazard Codes | Xi,C,T | Risk Statements | 36/37/38-36-25 | Safety Statements | 26-36/37/39-45 | RIDADR | UN 2810 | WGK Germany | 3 | Hazard Note | Irritant | HazardClass | CORROSIVE | HazardClass | 8 | PackingGroup | Ⅲ | HS Code | 29335990 |
| 2,4-Dichloro-5-trifluoromethylpyrimidine Usage And Synthesis |
Chemical Properties | White liquid or solid | Uses | 2,4-Dichloro-5-trifluoromethylpyrimidine is a reactant in the preparation of pyrimidine derivatives as inhibitors of gene ALK protein Kinase phosphorylating kinase and as cell proliferation inhibitors. |
| 2,4-Dichloro-5-trifluoromethylpyrimidine Preparation Products And Raw materials |
|