|
|
| | 3-(DICYANOMETHYLIDENE)INDAN-1-ONE Basic information |
| Product Name: | 3-(DICYANOMETHYLIDENE)INDAN-1-ONE | | Synonyms: | 3-(Dicyanomethylene)indian-1-one;Dicyanomethyleneindianone;3-(DICYANOMETHYLIDENE)INDAN-1-ONE;3-(DICYANOMETHYLIDENE)INDIAN-1-ONE;3-Dicycanovinylindan-1-one;3-(Dicyanomethlidene)indan-1-one;3-(DICYANOMETHYLIDENE)INDAN-1-ONE 98+%;(1-Oxoindan-3-ylidene)malononitrile | | CAS: | 1080-74-6 | | MF: | C12H6N2O | | MW: | 194.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1080-74-6.mol |  |
| | 3-(DICYANOMETHYLIDENE)INDAN-1-ONE Chemical Properties |
| Melting point | 228 °C | | Boiling point | 398.6±42.0 °C(Predicted) | | density | 1.351±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Brown | | InChI | InChI=1S/C12H6N2O/c13-6-8(7-14)11-5-12(15)10-4-2-1-3-9(10)11/h1-4H,5H2 | | InChIKey | QNVKZKOSAXYVFZ-UHFFFAOYSA-N | | SMILES | C(#N)/C(=C1/C2=C(C=CC=C2)C(=O)C/1)/C#N |
| RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 |
| | 3-(DICYANOMETHYLIDENE)INDAN-1-ONE Usage And Synthesis |
| Description | 3-(Dicyanomethylidene)indan-1-one, also named 2HIC, is a strong electron-withdrawing molecule. It can be used as electron-withdrawing acceptors to connect with donor to form acceptor–donor–acceptor (A–D–A)-type acceptor materials for the preparation of organic solar cells (OSCs). | | Uses | 3-(Dicyanomethylidene)indan-1-one is used in the preperation of polymer solar cells. |
| | 3-(DICYANOMETHYLIDENE)INDAN-1-ONE Preparation Products And Raw materials |
|