|
|
| | 3-Acetylbiphenyl Basic information |
| Product Name: | 3-Acetylbiphenyl | | Synonyms: | Ethanone, 1-[1,1'-biphenyl]-3-yl;3-PHENYLACETOPHENONE;1-(3-phenylphenyl)ethanone;3-ACETYLBIPHENYL;1-([1,1'-Biphenyl]-3-yl)ethanone | | CAS: | 3112-01-4 | | MF: | C14H12O | | MW: | 196.24 | | EINECS: | | | Product Categories: | | | Mol File: | 3112-01-4.mol |  |
| | 3-Acetylbiphenyl Chemical Properties |
| Melting point | 36 °C | | Boiling point | 137-138 °C(Press: 1 Torr) | | density | 1.053±0.06 g/cm3(Predicted) | | form | liquid | | color | White to light yellow | | InChI | InChI=1S/C14H12O/c1-11(15)13-8-5-9-14(10-13)12-6-3-2-4-7-12/h2-10H,1H3 | | InChIKey | HUHQPWCDGRZWMH-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=CC=C(C2=CC=CC=C2)C=1)C |
| HazardClass | IRRITANT | | HS Code | 2914390090 |
| | 3-Acetylbiphenyl Usage And Synthesis |
| Synthesis | 3-Acetylbiphenyl is prepared by reacting Phenylboronic acid with 1-(3-Chlorophenyl)ethanone reflux for 20 hours in prestence of Pd catalyst. | | Synthesis | Used as an intermediate in organic synthesis. |
| | 3-Acetylbiphenyl Preparation Products And Raw materials |
|