- XPhos Pd G4
-
- $0.00 / 1KG
-
2023-02-10
- CAS:1599466-81-5
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
|
| | XPhos Pd G4 Basic information |
| Product Name: | XPhos Pd G4 | | Synonyms: | (SP-4-3)-[Dicyclohexyl[2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine](methanesulfonato)[2'-(methylamino)[1,1'-biphenyl]-2-yl]palladium;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);METHANESULFONATO(2-DICYCLOHEXYLPHOSPHINO-2',4',6'-TRI-I-PROPYL-1,1'-BIPHENYL)(2'-METHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II),MIN.98%[XPHOSPALLADACYCLEGEN.4];Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),[XPhos Palladacycle Gen. 4];Xphos Palladacycle Gen.4;(2dicyclohexylphosphino2′,4′,6′triisopropyl1,1′biphenyl)[2(2′methylamino1,1′biphenyl)]palladium(II) methanesulfonate;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) /
XPhos Pd G4;Methanesulfonato(2-dicyclohexylphosphino-2',4',6'-... | | CAS: | 1599466-81-5 | | MF: | C47H64NO3PPdS | | MW: | 860.49 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1599466-81-5.mol |  |
| | XPhos Pd G4 Chemical Properties |
| Melting point | 150 °C | | form | Powder | | color | white to off-white | | InChIKey | RWNNUNWRORBXQJ-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| | XPhos Pd G4 Usage And Synthesis |
| Chemical Properties | Powder. Bench stable, soluble in most organic solvents. | | Uses | XPhos Pd G4 is a powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. | | Reactions | Palladium catalyst used in the Suzuki-Miyaura coupling of unstable boronic acids.
 |
| | XPhos Pd G4 Preparation Products And Raw materials |
|