|
| 4'-Hydroxy-4-biphenylcarbonitrile Basic information |
| 4'-Hydroxy-4-biphenylcarbonitrile Chemical Properties |
Melting point | 191-195 °C (lit.) | Boiling point | 331.88°C (rough estimate) | density | 1.1266 (rough estimate) | vapor pressure | 0.022 hPa (20 °C) | refractive index | 1.6060 (estimate) | storage temp. | Inert atmosphere,Room Temperature | solubility | 12.7g/l no data available | form | Crystalline Powder | pka | 9.43±0.26(Predicted) | color | Light yellow to beige | InChI | InChI=1S/C13H9NO/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8,15H | InChIKey | MDKUGDVEJBGKLD-UHFFFAOYSA-N | SMILES | C1(C2=CC=C(O)C=C2)=CC=C(C#N)C=C1 | CAS DataBase Reference | 19812-93-2(CAS DataBase Reference) | NIST Chemistry Reference | 4-Cyano-4'-hydroxybiphenyl(19812-93-2) |
| 4'-Hydroxy-4-biphenylcarbonitrile Usage And Synthesis |
Chemical Properties | light yellow to beige crystalline powder | Uses | Intermediates of Liquid Crystals |
| 4'-Hydroxy-4-biphenylcarbonitrile Preparation Products And Raw materials |
Raw materials | Copper(I) Cyanide-->4,4'-Biphenol-->4'-CYANO[1,1'-BIPHENYL]-4-YL ACETATE-->4’-hydroxybiphenyl-4-carboxamide-->4'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)biphenyl-4-carbonitrile-->4'-methoxy[1,1'-biphenyl]-4-carbonitrile-->4-Bromo-4'-hydroxybiphenyl-->4-Cyanophenylboronic acid-->4-Hydroxyphenylboronic acid-->4-Bromophenol-->4-Iodophenol | Preparation Products | 4,4'-BIPHENYLDICARBONITRILE-->4'-(Octyloxy)-4-biphenylcarbonitrile-->4-Propoxy-[1,1'-biphenyl]-4'-carbonitrile |
|