|
|
| | 2,6-Dichloro-3-fluoropyridine Chemical Properties |
| Melting point | 44-46°C | | Boiling point | 196.0±35.0 °C(Predicted) | | density | 1.498±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -3.21±0.10(Predicted) | | InChI | InChI=1S/C5H2Cl2FN/c6-4-2-1-3(8)5(7)9-4/h1-2H | | InChIKey | YAXSIJLRAOURJK-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC=C1F |
| RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933399990 |
| | 2,6-Dichloro-3-fluoropyridine Usage And Synthesis |
| Physical Form | White solid | | Synthesis | The venerable Balz and Schiemann reaction is the most powerful methodology for preparing aryl
fluorides. Not surprisingly, this reaction has been applied to the synthesis of fluoropyridines. Thus,
2,6-dichloro-3-fluoropyridine is readily prepared from 3-amino-2,6-dichloropyridine. The
method has been applied to combinatorial synthesis on the solid phase.
 |
| | 2,6-Dichloro-3-fluoropyridine Preparation Products And Raw materials |
|