Company Name: |
Shanghai Kuokun Biotechnology Co., Ltd Gold
|
Tel: |
15900929397 |
Email: |
3154863169@qq.com |
Products Intro: |
Product Name:5-Hydroxy-3-tert-butyl-salicylaldehyde CAS:192803-37-5 Purity:HPLC
≧95% Package:10g;100g
|
|
| 5-Hydroxy-3-tert-butyl-salicylaldehyde Basic information |
| 5-Hydroxy-3-tert-butyl-salicylaldehyde Chemical Properties |
Melting point | 140-142 °C | Boiling point | 295.9±35.0 °C(Predicted) | density | 1.179±0.06 g/cm3(Predicted) | pka | 10.10±0.23(Predicted) | InChI | InChI=1S/C11H14O3/c1-11(2,3)9-5-8(13)4-7(6-12)10(9)14/h4-6,13-14H,1-3H3 | InChIKey | TZZLDYZCZGLIJA-UHFFFAOYSA-N | SMILES | C(=O)C1=CC(O)=CC(C(C)(C)C)=C1O |
| 5-Hydroxy-3-tert-butyl-salicylaldehyde Usage And Synthesis |
Description |
3-Tert-butyl-2,5-dihydroxybenzaldehyde (5-Hydroxy-3-tert-butyl-salicylaldehyde) is an epoxide that contains a hydroxyl group. It is used in the synthesis of chiral epoxides and sulfoxides. This compound reacts with thionyl chloride to produce sulfoxide compounds. The reaction between 3-tent-butyl-2,5-dihydroxybenzaldehyde and hydrogen peroxide produces a chiral epoxide, which can be oxidized to form an aldehyde or reduced to a ketone. This chemical has been shown to react with chloride ions in the presence of an oxidant such as potassium permanganate or peroxy trifluoroacetic acid, forming chlorinated derivatives.
|
| 5-Hydroxy-3-tert-butyl-salicylaldehyde Preparation Products And Raw materials |
|