Lefamulin manufacturers
- Lefamulin
-
- $0.00 / 1KG
-
2023-06-14
- CAS:1061337-51-6
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: 1000KGS
|
| | Lefamulin Basic information |
| Product Name: | Lefamulin | | Synonyms: | Lefamulin;BC 3781;Lefamulin(BC-3781);Acetic acid, 2-[[(1R,2R,4R)-4-amino-2-hydroxycyclohexyl]thio]-, (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester;2-[[(1R,2R,4R)-4-Amino-2-hydroxycyclohexyl]thio]acetic acid (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester | | CAS: | 1061337-51-6 | | MF: | C28H45NO5S | | MW: | 507.73 | | EINECS: | | | Product Categories: | API | | Mol File: | 1061337-51-6.mol |  |
| | Lefamulin Chemical Properties |
| Boiling point | 618.6±55.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | solubility | DMF: 16 mg/mL; DMSO: 12 mg/mL; Ethanol: 3 mg/mL; PBS (pH 7.2): 0.25 mg/mL | | form | A solid | | pka | 14.45±0.60(Predicted) | | InChIKey | KPVIXBKIJXZQJX-FCEONZPQSA-N | | SMILES | C(O[C@@H]1C[C@](C=C)(C)[C@@H](O)[C@H](C)[C@@]23CC[C@@H](C)[C@]1(C)[C@]2([H])C(=O)CC3)(=O)CS[C@@H]1CC[C@@H](N)C[C@H]1O |
| | Lefamulin Usage And Synthesis |
| Uses | Lefamulin is an antibiotic medication used in the treatment of adults with community-acquired bacterial pneumonia. |
| | Lefamulin Preparation Products And Raw materials |
| Raw materials | Cyclohexene, 4-isocyanato-, (4R)--->Acetic acid, 2-[[(1R,2R,4R)-2-hydroxy-4-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]thio]-, (3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester-->1350636-88-2-->tert-butyl N-[(1R)-cyclohex-3-en-1-yl]carbamate-->tert-butyl N-[(1R,3R,4R)-3-hydroxy-4-sulfanylcyclohexyl]carbamate-->TiaMulin Related CoMpound A-->{(1R,2R,4R)-4-[(tert-butoxycarbonyl)-amino]-2-hydroxy-cyclohexyl} benzene-carbothioate-->(R)-(+)-3-CYCLOHEXENECARBOXYLIC ACID-->3-Cyclohexenecarboxylic acid | | Preparation Products | WSMXIQXWHPSVDE-WHAUHWDVSA-N |
|